C33H38Cl2F3N3O2 — CID 162576653
9-[4-[4-[(3,6-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]piperidin-1-yl]butyl]-3-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydrofluorene-9-carboxamide (PubChem CID 162576653) has the molecular formula C33H38Cl2F3N3O2 and a molecular weight of 636.59 g/mol. Its IUPAC name is 9-[4-[4-[(3,6-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]piperidin-1-yl]butyl]-3-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydrofluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(3,6-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]piperidin-1-yl]butyl]-3-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydrofluorene-9-carboxamide |
|---|---|
| PubChem CID | 162576653 |
| Molecular Formula | C33H38Cl2F3N3O2 |
| Molecular Weight | 636.59 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | 9-[4-[4-[(3,6-dichlorocyclohexa-2,4-diene-1-carbonyl)amino]piperidin-1-yl]butyl]-3-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydrofluorene-9-carboxamide |
| SMILES | CC1C=CC2=C(C1)c1ccccc1C2(CCCCN1CCC(NC(=O)C2C=C(Cl)C=CC2Cl)CC1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C33H38Cl2F3N3O2/c1-21-8-10-28-25(18-21)24-6-2-3-7-27(24)32(28,31(43)39-20-33(36,37)38)14-4-5-15-41-16-12-23(13-17-41)40-30(42)26-19-22(34)9-11-29(26)35/h2-3,6-11,19,21,23,26,29H,4-5,12-18,20H2,1H3,(H,39,43)(H,40,42) |
| InChIKey | GIEIJSFIMFOTAJ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|