C11H9N3O6 — CID 162625194
2,4-dinitrophenolate;pyridin-1-ium-4-ol (PubChem CID 162625194) has the molecular formula C11H9N3O6 and a molecular weight of 279.21 g/mol. Its IUPAC name is 2,4-dinitrophenolate;pyridin-1-ium-4-ol.
| Compound Name | 2,4-dinitrophenolate;pyridin-1-ium-4-ol |
|---|---|
| PubChem CID | 162625194 |
| Molecular Formula | C11H9N3O6 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2,4-dinitrophenolate;pyridin-1-ium-4-ol |
| SMILES | O=[N+]([O-])c1ccc([O-])c([N+](=O)[O-])c1.Oc1cc[nH+]cc1 |
| InChI | InChI=1S/C6H4N2O5.C5H5NO/c9-6-2-1-4(7(10)11)3-5(6)8(12)13;7-5-1-3-6-4-2-5/h1-3,9H;1-4H,(H,6,7) |
| InChIKey | LXUPSIZMFCEKFG-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|