C27H31ClN6O5 — CID 162736616
N-[3-chloro-4-[(Z)-2-methyliminohex-3-enoxy]phenyl]-7-(2-morpholin-4-ylethoxy)-6-nitroquinazolin-4-amine (PubChem CID 162736616) has the molecular formula C27H31ClN6O5 and a molecular weight of 555.04 g/mol. Its IUPAC name is N-[3-chloro-4-[(Z)-2-methyliminohex-3-enoxy]phenyl]-7-(2-morpholin-4-ylethoxy)-6-nitroquinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(Z)-2-methyliminohex-3-enoxy]phenyl]-7-(2-morpholin-4-ylethoxy)-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 162736616 |
| Molecular Formula | C27H31ClN6O5 |
| Molecular Weight | 555.04 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-[3-chloro-4-[(Z)-2-methyliminohex-3-enoxy]phenyl]-7-(2-morpholin-4-ylethoxy)-6-nitroquinazolin-4-amine |
| SMILES | CC/C=C\C(COc1ccc(Nc2ncnc3cc(OCCN4CCOCC4)c([N+](=O)[O-])cc23)cc1Cl)=N/C |
| InChI | InChI=1S/C27H31ClN6O5/c1-3-4-5-20(29-2)17-39-25-7-6-19(14-22(25)28)32-27-21-15-24(34(35)36)26(16-23(21)30-18-31-27)38-13-10-33-8-11-37-12-9-33/h4-7,14-16,18H,3,8-13,17H2,1-2H3,(H,30,31,32)/b5-4-,29-20+ |
| InChIKey | LFGFHNCNEXYJMZ-PXHKLYEBSA-N |
| XLogP | 5.06 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.04 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|