C17H16N2O — CID 162754828
7-ethenyl-6-methanimidoyl-8,9-dimethylcarbazol-3-ol (PubChem CID 162754828) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 7-ethenyl-6-methanimidoyl-8,9-dimethylcarbazol-3-ol.
| Compound Name | 7-ethenyl-6-methanimidoyl-8,9-dimethylcarbazol-3-ol |
|---|---|
| PubChem CID | 162754828 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 7-ethenyl-6-methanimidoyl-8,9-dimethylcarbazol-3-ol |
| SMILES | [H]/N=C/c1cc2c3cc(O)ccc3n(C)c2c(C)c1C=C |
| InChI | InChI=1S/C17H16N2O/c1-4-13-10(2)17-15(7-11(13)9-18)14-8-12(20)5-6-16(14)19(17)3/h4-9,18,20H,1H2,2-3H3/b18-9+ |
| InChIKey | YYCXATSZDMFXAU-GIJQJNRQSA-N |
| XLogP | 3.99 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|