C20H26O3 — CID 162858673
(2R)-2-[5-(furan-3-yl)pent-2-en-2-yl]-5-(4-methylpent-3-enyl)-2,3-dihydropyran-6-one (PubChem CID 162858673) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2R)-2-[5-(furan-3-yl)pent-2-en-2-yl]-5-(4-methylpent-3-enyl)-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[5-(furan-3-yl)pent-2-en-2-yl]-5-(4-methylpent-3-enyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162858673 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (2R)-2-[5-(furan-3-yl)pent-2-en-2-yl]-5-(4-methylpent-3-enyl)-2,3-dihydropyran-6-one |
| SMILES | CC(C)=CCCC1=CC[C@H](C(C)=CCCc2ccoc2)OC1=O |
| InChI | InChI=1S/C20H26O3/c1-15(2)6-4-9-18-10-11-19(23-20(18)21)16(3)7-5-8-17-12-13-22-14-17/h6-7,10,12-14,19H,4-5,8-9,11H2,1-3H3/t19-/m1/s1 |
| InChIKey | HERRARRWFUSVSA-LJQANCHMSA-N |
| XLogP | 5.15 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|