C22H28O8 — CID 162873694
[(3R,4aS,10aR)-5,6,8-trihydroxy-7-[(2S)-1-hydroxypropan-2-yl]-1,1,4a-trimethyl-9,10-dioxo-2,3,4,10a-tetrahydrophenanthren-3-yl] acetate (PubChem CID 162873694) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is [(3R,4aS,10aR)-5,6,8-trihydroxy-7-[(2S)-1-hydroxypropan-2-yl]-1,1,4a-trimethyl-9,10-dioxo-2,3,4,10a-tetrahydrophenanthren-3-yl] acetate.
| Compound Name | [(3R,4aS,10aR)-5,6,8-trihydroxy-7-[(2S)-1-hydroxypropan-2-yl]-1,1,4a-trimethyl-9,10-dioxo-2,3,4,10a-tetrahydrophenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 162873694 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | [(3R,4aS,10aR)-5,6,8-trihydroxy-7-[(2S)-1-hydroxypropan-2-yl]-1,1,4a-trimethyl-9,10-dioxo-2,3,4,10a-tetrahydrophenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(C)(C)[C@H]2C(=O)C(=O)c3c(O)c([C@H](C)CO)c(O)c(O)c3[C@@]2(C)C1 |
| InChI | InChI=1S/C22H28O8/c1-9(8-23)12-15(25)13-14(18(28)16(12)26)22(5)7-11(30-10(2)24)6-21(3,4)20(22)19(29)17(13)27/h9,11,20,23,25-26,28H,6-8H2,1-5H3/t9-,11-,20-,22-/m1/s1 |
| InChIKey | INOOPOXHUHWXMU-QHTZQTHFSA-N |
| XLogP | 2.29 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|