C22H36O4 — CID 162949368
(2R,3R,6S)-2-[[(1S,2R,4S)-4-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-2-hydroxy-2-methylcyclopentyl]methyl]-3,6-dihydroxycyclohexan-1-one (PubChem CID 162949368) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (2R,3R,6S)-2-[[(1S,2R,4S)-4-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-2-hydroxy-2-methylcyclopentyl]methyl]-3,6-dihydroxycyclohexan-1-one.
| Compound Name | (2R,3R,6S)-2-[[(1S,2R,4S)-4-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-2-hydroxy-2-methylcyclopentyl]methyl]-3,6-dihydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 162949368 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (2R,3R,6S)-2-[[(1S,2R,4S)-4-[(1Z)-2,6-dimethylhepta-1,5-dienyl]-2-hydroxy-2-methylcyclopentyl]methyl]-3,6-dihydroxycyclohexan-1-one |
| SMILES | CC(C)=CCC/C(C)=C\[C@H]1C[C@@H](C[C@H]2C(=O)[C@@H](O)CC[C@H]2O)[C@](C)(O)C1 |
| InChI | InChI=1S/C22H36O4/c1-14(2)6-5-7-15(3)10-16-11-17(22(4,26)13-16)12-18-19(23)8-9-20(24)21(18)25/h6,10,16-20,23-24,26H,5,7-9,11-13H2,1-4H3/b15-10-/t16-,17-,18+,19+,20-,22+/m0/s1 |
| InChIKey | ARWRGDYUCCALTP-OMRMVFIQSA-N |
| XLogP | 3.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|