C13H13N5O5 — CID 163122450
N,2-dihydroxy-5-[(3-methyl-2,6-dioxopurin-7-yl)methyl]benzeneamine oxide (PubChem CID 163122450) has the molecular formula C13H13N5O5 and a molecular weight of 319.28 g/mol. Its IUPAC name is N,2-dihydroxy-5-[(3-methyl-2,6-dioxopurin-7-yl)methyl]benzeneamine oxide.
| Compound Name | N,2-dihydroxy-5-[(3-methyl-2,6-dioxopurin-7-yl)methyl]benzeneamine oxide |
|---|---|
| PubChem CID | 163122450 |
| Molecular Formula | C13H13N5O5 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N,2-dihydroxy-5-[(3-methyl-2,6-dioxopurin-7-yl)methyl]benzeneamine oxide |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1ncn2Cc1ccc(O)c([NH+]([O-])O)c1 |
| InChI | InChI=1S/C13H13N5O5/c1-16-11-10(12(20)15-13(16)21)17(6-14-11)5-7-2-3-9(19)8(4-7)18(22)23/h2-4,6,18-19,22H,5H2,1H3,(H,15,20,21) |
| InChIKey | BZJKCXNNXYRGOJ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|