About ethane;(3S)-3-methylpentanamide;1-phenylethanone
ethane;(3S)-3-methylpentanamide;1-phenylethanone (PubChem CID 163293272) has the molecular formula C16H27NO2
and a molecular weight of 265.40 g/mol. Its IUPAC name is ethane;(3S)-3-methylpentanamide;1-phenylethanone.
Molecular Properties
| Compound Name | ethane;(3S)-3-methylpentanamide;1-phenylethanone |
| PubChem CID | 163293272 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | ethane;(3S)-3-methylpentanamide;1-phenylethanone |
| SMILES | CC.CC(=O)c1ccccc1.CC[C@H](C)CC(N)=O |
| InChI | InChI=1S/C8H8O.C6H13NO.C2H6/c1-7(9)8-5-3-2-4-6-8;1-3-5(2)4-6(7)8;1-2/h2-6H,1H3;5H,3-4H2,1-2H3,(H2,7,8);1-2H3/t;5-;/m.0./s1 |
| InChIKey | HQYMGPQFNQWVJC-NXAOXGSFSA-N |
| XLogP | 3.82 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(3S)-3-methylpentanamide;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3S)-3-methylpentanamide;1-phenylethanone?
The IUPAC name of ethane;(3S)-3-methylpentanamide;1-phenylethanone (CID 163293272) is ethane;(3S)-3-methylpentanamide;1-phenylethanone.
What is the SMILES notation for ethane;(3S)-3-methylpentanamide;1-phenylethanone?
The canonical SMILES for ethane;(3S)-3-methylpentanamide;1-phenylethanone is CC.CC(=O)c1ccccc1.CC[C@H](C)CC(N)=O.
What is the InChIKey of ethane;(3S)-3-methylpentanamide;1-phenylethanone?
The InChIKey is HQYMGPQFNQWVJC-NXAOXGSFSA-N. The full InChI is InChI=1S/C8H8O.C6H13NO.C2H6/c1-7(9)8-5-3-2-4-6-8;1-3-5(2)4-6(7)8;1-2/h2-6H,1H3;5H,3-4H2,1-2H3,(H2,7,8);1-2H3/t;5-;/m.0./s1.
What are the key properties of ethane;(3S)-3-methylpentanamide;1-phenylethanone?
ethane;(3S)-3-methylpentanamide;1-phenylethanone has a molecular weight of 265.40 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3S)-3-methylpentanamide;1-phenylethanone is sourced from PubChem (CID 163293272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).