C9H12F2N2O7S — CID 163418900
1,1-difluoro-2-[2-(5-methyl-4,5-dihydroimidazole-1-carbonyl)oxyethoxy]-2-oxoethanesulfonic acid (PubChem CID 163418900) has the molecular formula C9H12F2N2O7S and a molecular weight of 330.27 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(5-methyl-4,5-dihydroimidazole-1-carbonyl)oxyethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(5-methyl-4,5-dihydroimidazole-1-carbonyl)oxyethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163418900 |
| Molecular Formula | C9H12F2N2O7S |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 1,1-difluoro-2-[2-(5-methyl-4,5-dihydroimidazole-1-carbonyl)oxyethoxy]-2-oxoethanesulfonic acid |
| SMILES | CC1CN=CN1C(=O)OCCOC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C9H12F2N2O7S/c1-6-4-12-5-13(6)8(15)20-3-2-19-7(14)9(10,11)21(16,17)18/h5-6H,2-4H2,1H3,(H,16,17,18) |
| InChIKey | AGTSAJWREHZXOI-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|