C13H18F2O5S — CID 163727198
1,1-difluoro-2-[2-(5-methyl-3-tricyclo[5.1.0.01,3]octanyl)ethoxy]-2-oxoethanesulfonic acid (PubChem CID 163727198) has the molecular formula C13H18F2O5S and a molecular weight of 324.35 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-(5-methyl-3-tricyclo[5.1.0.01,3]octanyl)ethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-(5-methyl-3-tricyclo[5.1.0.01,3]octanyl)ethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 163727198 |
| Molecular Formula | C13H18F2O5S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1,1-difluoro-2-[2-(5-methyl-3-tricyclo[5.1.0.01,3]octanyl)ethoxy]-2-oxoethanesulfonic acid |
| SMILES | CC1CC2CC23CC3(CCOC(=O)C(F)(F)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H18F2O5S/c1-8-4-9-6-12(9)7-11(12,5-8)2-3-20-10(16)13(14,15)21(17,18)19/h8-9H,2-7H2,1H3,(H,17,18,19) |
| InChIKey | KWPJQHABTONSOF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|