C19H42N6O2 — CID 163596599
(2S)-N-[1-amino-6-methyl-6-[2-(methylamino)ethylamino]-5-oxoheptan-4-yl]-2,6-bis(methylamino)hexanamide (PubChem CID 163596599) has the molecular formula C19H42N6O2 and a molecular weight of 386.59 g/mol. Its IUPAC name is (2S)-N-[1-amino-6-methyl-6-[2-(methylamino)ethylamino]-5-oxoheptan-4-yl]-2,6-bis(methylamino)hexanamide.
| Compound Name | (2S)-N-[1-amino-6-methyl-6-[2-(methylamino)ethylamino]-5-oxoheptan-4-yl]-2,6-bis(methylamino)hexanamide |
|---|---|
| PubChem CID | 163596599 |
| Molecular Formula | C19H42N6O2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | (2S)-N-[1-amino-6-methyl-6-[2-(methylamino)ethylamino]-5-oxoheptan-4-yl]-2,6-bis(methylamino)hexanamide |
| SMILES | CNCCCC[C@H](NC)C(=O)NC(CCCN)C(=O)C(C)(C)NCCNC |
| InChI | InChI=1S/C19H42N6O2/c1-19(2,24-14-13-22-4)17(26)15(10-8-11-20)25-18(27)16(23-5)9-6-7-12-21-3/h15-16,21-24H,6-14,20H2,1-5H3,(H,25,27)/t15?,16-/m0/s1 |
| InChIKey | GTZDRFMTSRTADV-LYKKTTPLSA-N |
| XLogP | -0.66 |
| TPSA | 120.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|