C32H54N2O7Si — CID 163674950
2-trimethylsilylethyl (3R)-3-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]-8,8-dimethylnonanoate (PubChem CID 163674950) has the molecular formula C32H54N2O7Si and a molecular weight of 606.88 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3R)-3-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]-8,8-dimethylnonanoate.
| Compound Name | 2-trimethylsilylethyl (3R)-3-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]-8,8-dimethylnonanoate |
|---|---|
| PubChem CID | 163674950 |
| Molecular Formula | C32H54N2O7Si |
| Molecular Weight | 606.88 g/mol |
| Exact Mass | 606.37 |
| IUPAC Name | 2-trimethylsilylethyl (3R)-3-[[(2S)-1-methoxy-1-oxo-6-(phenylmethoxycarbonylamino)hexan-2-yl]carbamoyl]-8,8-dimethylnonanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NC(=O)[C@H](CCCCC(C)(C)C)CC(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C32H54N2O7Si/c1-32(2,3)19-13-11-17-26(23-28(35)40-21-22-42(5,6)7)29(36)34-27(30(37)39-4)18-12-14-20-33-31(38)41-24-25-15-9-8-10-16-25/h8-10,15-16,26-27H,11-14,17-24H2,1-7H3,(H,33,38)(H,34,36)/t26-,27+/m1/s1 |
| InChIKey | XSVAYLKGZYBFQJ-SXOMAYOGSA-N |
| XLogP | 6.24 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.88 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|