About (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole
(2R)-2-amino-3-sulfanylpropanoic acid;1H-indole (PubChem CID 163856546) has the molecular formula C11H14N2O2S
and a molecular weight of 238.31 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole.
Molecular Properties
| Compound Name | (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole |
| PubChem CID | 163856546 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole |
| SMILES | N[C@@H](CS)C(=O)O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C3H7NO2S/c1-2-4-8-7(3-1)5-6-9-8;4-2(1-7)3(5)6/h1-6,9H;2,7H,1,4H2,(H,5,6)/t;2-/m.0/s1 |
| InChIKey | OYUCWYBAHUTYSV-WNQIDUERSA-N |
| XLogP | 1.50 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole?
The IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole (CID 163856546) is (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole.
What is the SMILES notation for (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole?
The canonical SMILES for (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole is N[C@@H](CS)C(=O)O.c1ccc2[nH]ccc2c1.
What is the InChIKey of (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole?
The InChIKey is OYUCWYBAHUTYSV-WNQIDUERSA-N. The full InChI is InChI=1S/C8H7N.C3H7NO2S/c1-2-4-8-7(3-1)5-6-9-8;4-2(1-7)3(5)6/h1-6,9H;2,7H,1,4H2,(H,5,6)/t;2-/m.0/s1.
What are the key properties of (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole?
(2R)-2-amino-3-sulfanylpropanoic acid;1H-indole has a molecular weight of 238.31 g/mol, XLogP of 1.50, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-sulfanylpropanoic acid;1H-indole is sourced from PubChem (CID 163856546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).