C10H16N2O2 — CID 163903609
(2R)-2-(4,5-diamino-6-methylcyclohexa-2,4-dien-1-yl)cyclopropane-1,1-diol (PubChem CID 163903609) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2R)-2-(4,5-diamino-6-methylcyclohexa-2,4-dien-1-yl)cyclopropane-1,1-diol.
| Compound Name | (2R)-2-(4,5-diamino-6-methylcyclohexa-2,4-dien-1-yl)cyclopropane-1,1-diol |
|---|---|
| PubChem CID | 163903609 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | (2R)-2-(4,5-diamino-6-methylcyclohexa-2,4-dien-1-yl)cyclopropane-1,1-diol |
| SMILES | CC1C(N)=C(N)C=CC1[C@H]1CC1(O)O |
| InChI | InChI=1S/C10H16N2O2/c1-5-6(7-4-10(7,13)14)2-3-8(11)9(5)12/h2-3,5-7,13-14H,4,11-12H2,1H3/t5?,6?,7-/m1/s1 |
| InChIKey | QLZIHGWRESTQNR-KPGICGJXSA-N |
| XLogP | -0.36 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|