C21H30O — CID 164531188
(2E,4E)-4-[(E)-but-2-en-2-yl]-1-(3-methylcyclohex-2-en-1-yl)hepta-2,4-dien-6-yn-2-ol;prop-1-ene (PubChem CID 164531188) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (2E,4E)-4-[(E)-but-2-en-2-yl]-1-(3-methylcyclohex-2-en-1-yl)hepta-2,4-dien-6-yn-2-ol;prop-1-ene.
| Compound Name | (2E,4E)-4-[(E)-but-2-en-2-yl]-1-(3-methylcyclohex-2-en-1-yl)hepta-2,4-dien-6-yn-2-ol;prop-1-ene |
|---|---|
| PubChem CID | 164531188 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2E,4E)-4-[(E)-but-2-en-2-yl]-1-(3-methylcyclohex-2-en-1-yl)hepta-2,4-dien-6-yn-2-ol;prop-1-ene |
| SMILES | C#C/C=C(\C=C(\O)CC1C=C(C)CCC1)C(/C)=C/C.C=CC |
| InChI | InChI=1S/C18H24O.C3H6/c1-5-8-17(15(4)6-2)13-18(19)12-16-10-7-9-14(3)11-16;1-3-2/h1,6,8,11,13,16,19H,7,9-10,12H2,2-4H3;3H,1H2,2H3/b15-6+,17-8+,18-13+; |
| InChIKey | CXSBVWJDIANEKG-RSSOLDMUSA-N |
| XLogP | 6.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|