C22H20F3N4O4+ — CID 164928603
3-[(2S)-but-3-en-2-yl]-5-hydroxy-4,6-dioxo-1-prop-2-enyl-N-[(2,4,6-trifluorophenyl)methyl]pyrido[2,1-f][1,2,4]triazin-1-ium-7-carboxamide (PubChem CID 164928603) has the molecular formula C22H20F3N4O4+ and a molecular weight of 461.42 g/mol. Its IUPAC name is 3-[(2S)-but-3-en-2-yl]-5-hydroxy-4,6-dioxo-1-prop-2-enyl-N-[(2,4,6-trifluorophenyl)methyl]pyrido[2,1-f][1,2,4]triazin-1-ium-7-carboxamide.
| Compound Name | 3-[(2S)-but-3-en-2-yl]-5-hydroxy-4,6-dioxo-1-prop-2-enyl-N-[(2,4,6-trifluorophenyl)methyl]pyrido[2,1-f][1,2,4]triazin-1-ium-7-carboxamide |
|---|---|
| PubChem CID | 164928603 |
| Molecular Formula | C22H20F3N4O4+ |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[(2S)-but-3-en-2-yl]-5-hydroxy-4,6-dioxo-1-prop-2-enyl-N-[(2,4,6-trifluorophenyl)methyl]pyrido[2,1-f][1,2,4]triazin-1-ium-7-carboxamide |
| SMILES | C=CC[n+]1cn([C@@H](C)C=C)c(=O)c2c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn21 |
| InChI | InChI=1S/C22H19F3N4O4/c1-4-6-27-11-28(12(3)5-2)22(33)18-20(31)19(30)15(10-29(18)27)21(32)26-9-14-16(24)7-13(23)8-17(14)25/h4-5,7-8,10-12H,1-2,6,9H2,3H3,(H-,26,31,32,33)/p+1/t12-/m0/s1 |
| InChIKey | RKXNYGSPGRWQFX-LBPRGKRZSA-O |
| XLogP | 1.73 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|