C26H28N4O9S — CID 165175515
2-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]ethoxy]ethyl]-4-methylbenzenesulfonic acid (PubChem CID 165175515) has the molecular formula C26H28N4O9S and a molecular weight of 572.60 g/mol. Its IUPAC name is 2-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]ethoxy]ethyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]ethoxy]ethyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 165175515 |
| Molecular Formula | C26H28N4O9S |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | 2-[2-[2-[[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]acetyl]amino]ethoxy]ethyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCCNC(=O)CNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C26H28N4O9S/c1-15-5-7-20(40(36,37)38)16(13-15)9-11-39-12-10-27-22(32)14-28-18-4-2-3-17-23(18)26(35)30(25(17)34)19-6-8-21(31)29-24(19)33/h2-5,7,13,19,28H,6,8-12,14H2,1H3,(H,27,32)(H,29,31,33)(H,36,37,38) |
| InChIKey | CPHSFPOPCXPAMC-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 188.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|