C33H49N — CID 165403541
4-[(11R,12S,15S,16R,18R)-5-cyclopropyl-16-methyl-15-propyl-18-tetracyclo[9.7.0.02,7.012,16]octadec-1-enyl]-N,N-dimethylaniline (PubChem CID 165403541) has the molecular formula C33H49N and a molecular weight of 459.76 g/mol. Its IUPAC name is 4-[(11R,12S,15S,16R,18R)-5-cyclopropyl-16-methyl-15-propyl-18-tetracyclo[9.7.0.02,7.012,16]octadec-1-enyl]-N,N-dimethylaniline.
| Compound Name | 4-[(11R,12S,15S,16R,18R)-5-cyclopropyl-16-methyl-15-propyl-18-tetracyclo[9.7.0.02,7.012,16]octadec-1-enyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 165403541 |
| Molecular Formula | C33H49N |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 459.39 |
| IUPAC Name | 4-[(11R,12S,15S,16R,18R)-5-cyclopropyl-16-methyl-15-propyl-18-tetracyclo[9.7.0.02,7.012,16]octadec-1-enyl]-N,N-dimethylaniline |
| SMILES | CCC[C@H]1CC[C@H]2[C@H]3CCCC4CC(C5CC5)CCC4=C3[C@@H](c3ccc(N(C)C)cc3)C[C@]12C |
| InChI | InChI=1S/C33H49N/c1-5-7-26-15-19-31-29-9-6-8-25-20-24(22-10-11-22)14-18-28(25)32(29)30(21-33(26,31)2)23-12-16-27(17-13-23)34(3)4/h12-13,16-17,22,24-26,29-31H,5-11,14-15,18-21H2,1-4H3/t24?,25?,26-,29+,30+,31-,33+/m0/s1 |
| InChIKey | RALOLVDQKANZRZ-GPXBRZOJSA-N |
| XLogP | 9.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|