C13H14N10O3 — CID 166594883
2-amino-3-[3-(2-amino-6-oxo-7H-purin-3-yl)-3-hydroxypropyl]-7H-purin-6-one (PubChem CID 166594883) has the molecular formula C13H14N10O3 and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-amino-3-[3-(2-amino-6-oxo-7H-purin-3-yl)-3-hydroxypropyl]-7H-purin-6-one.
| Compound Name | 2-amino-3-[3-(2-amino-6-oxo-7H-purin-3-yl)-3-hydroxypropyl]-7H-purin-6-one |
|---|---|
| PubChem CID | 166594883 |
| Molecular Formula | C13H14N10O3 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 2-amino-3-[3-(2-amino-6-oxo-7H-purin-3-yl)-3-hydroxypropyl]-7H-purin-6-one |
| SMILES | Nc1nc(=O)c2[nH]cnc2n1CCC(O)n1c(N)nc(=O)c2[nH]cnc21 |
| InChI | InChI=1S/C13H14N10O3/c14-12-20-10(25)6-8(18-3-16-6)22(12)2-1-5(24)23-9-7(17-4-19-9)11(26)21-13(23)15/h3-5,24H,1-2H2,(H,16,18)(H,17,19)(H2,14,20,25)(H2,15,21,26) |
| InChIKey | PMLYEOXNPHTBKB-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 199.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |