C10H10N10O4 — CID 137184580
2-amino-7,9-dihydro-1H-purine-6,8-dione;2-amino-3-hydroxy-7H-purin-6-one (PubChem CID 137184580) has the molecular formula C10H10N10O4 and a molecular weight of 334.26 g/mol. Its IUPAC name is 2-amino-7,9-dihydro-1H-purine-6,8-dione;2-amino-3-hydroxy-7H-purin-6-one.
| Compound Name | 2-amino-7,9-dihydro-1H-purine-6,8-dione;2-amino-3-hydroxy-7H-purin-6-one |
|---|---|
| PubChem CID | 137184580 |
| Molecular Formula | C10H10N10O4 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-amino-7,9-dihydro-1H-purine-6,8-dione;2-amino-3-hydroxy-7H-purin-6-one |
| SMILES | Nc1nc(=O)c2[nH]cnc2n1O.Nc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/2C5H5N5O2/c6-5-9-4(11)2-3(10(5)12)8-1-7-2;6-4-8-2-1(3(11)10-4)7-5(12)9-2/h1,12H,(H,7,8)(H2,6,9,11);(H5,6,7,8,9,10,11,12) |
| InChIKey | CIYTZRNONLOKCK-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 230.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|