C10H7N9O4 — CID 135854125
2-amino-7,9-dihydro-1H-purine-6,8-dione;1H-purine-6,8-dione (PubChem CID 135854125) has the molecular formula C10H7N9O4 and a molecular weight of 317.23 g/mol. Its IUPAC name is 2-amino-7,9-dihydro-1H-purine-6,8-dione;1H-purine-6,8-dione.
| Compound Name | 2-amino-7,9-dihydro-1H-purine-6,8-dione;1H-purine-6,8-dione |
|---|---|
| PubChem CID | 135854125 |
| Molecular Formula | C10H7N9O4 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-amino-7,9-dihydro-1H-purine-6,8-dione;1H-purine-6,8-dione |
| SMILES | Nc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1.O=C1N=c2nc[nH]c(=O)c2=N1 |
| InChI | InChI=1S/C5H5N5O2.C5H2N4O2/c6-4-8-2-1(3(11)10-4)7-5(12)9-2;10-4-2-3(6-1-7-4)9-5(11)8-2/h(H5,6,7,8,9,10,11,12);1H,(H,6,7,9,10,11) |
| InChIKey | SQMSQGJIEWGVGH-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 207.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |