C8H7N5O — CID 136636166
6,9-dihydro-3H-pyrimido[2,1-b]purin-4-one (PubChem CID 136636166) has the molecular formula C8H7N5O and a molecular weight of 189.18 g/mol. Its IUPAC name is 6,9-dihydro-3H-pyrimido[2,1-b]purin-4-one.
| Compound Name | 6,9-dihydro-3H-pyrimido[2,1-b]purin-4-one |
|---|---|
| PubChem CID | 136636166 |
| Molecular Formula | C8H7N5O |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | 6,9-dihydro-3H-pyrimido[2,1-b]purin-4-one |
| SMILES | O=c1nc2n(c3nc[nH]c13)CC=CN2 |
| InChI | InChI=1S/C8H7N5O/c14-7-5-6(11-4-10-5)13-3-1-2-9-8(13)12-7/h1-2,4H,3H2,(H,10,11)(H,9,12,14) |
| InChIKey | BTCKTDQGOCLURL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |