About Butyldimethylamine Cyanofluoroborane
Butyldimethylamine Cyanofluoroborane (PubChem CID 16661664) has the molecular formula C7H15BFN2
and a molecular weight of 157.02 g/mol.
Molecular Properties
| Compound Name | Butyldimethylamine Cyanofluoroborane |
| PubChem CID | 16661664 |
| Molecular Formula | C7H15BFN2 |
| Molecular Weight | 157.02 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | — |
| SMILES | CCCCN(C)C.N#C[B]F |
| InChI | InChI=1S/C6H15N.CBFN/c1-4-5-6-7(2)3;3-2-1-4/h4-6H2,1-3H3; |
| InChIKey | WQYMKEUFZCEWPU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.02 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Butyldimethylamine Cyanofluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butyldimethylamine Cyanofluoroborane?
The IUPAC name of Butyldimethylamine Cyanofluoroborane (CID 16661664) is not available.
What is the SMILES notation for Butyldimethylamine Cyanofluoroborane?
The canonical SMILES for Butyldimethylamine Cyanofluoroborane is CCCCN(C)C.N#C[B]F.
What is the InChIKey of Butyldimethylamine Cyanofluoroborane?
The InChIKey is WQYMKEUFZCEWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CBFN/c1-4-5-6-7(2)3;3-2-1-4/h4-6H2,1-3H3;.
What are the key properties of Butyldimethylamine Cyanofluoroborane?
Butyldimethylamine Cyanofluoroborane has a molecular weight of 157.02 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Butyldimethylamine Cyanofluoroborane is sourced from PubChem (CID 16661664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).