C20H32N6O6S — CID 166637570
ditert-butyl (2S)-2-[[2-amino-2-(7H-purin-6-yl)ethyl]sulfonylamino]pentanedioate (PubChem CID 166637570) has the molecular formula C20H32N6O6S and a molecular weight of 484.58 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[2-amino-2-(7H-purin-6-yl)ethyl]sulfonylamino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[2-amino-2-(7H-purin-6-yl)ethyl]sulfonylamino]pentanedioate |
|---|---|
| PubChem CID | 166637570 |
| Molecular Formula | C20H32N6O6S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | ditert-butyl (2S)-2-[[2-amino-2-(7H-purin-6-yl)ethyl]sulfonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NS(=O)(=O)CC(N)c1ncnc2nc[nH]c12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N6O6S/c1-19(2,3)31-14(27)8-7-13(18(28)32-20(4,5)6)26-33(29,30)9-12(21)15-16-17(24-10-22-15)25-11-23-16/h10-13,26H,7-9,21H2,1-6H3,(H,22,23,24,25)/t12?,13-/m0/s1 |
| InChIKey | OTZXEZOQENPRJP-ABLWVSNPSA-N |
| XLogP | 1.10 |
| TPSA | 179.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |