C33H32F3NO6 — CID 166980292
(Z)-4-oxo-4-[4-[4-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]prop-2-enoyl]oxybutyl]anilino]but-2-enoic acid (PubChem CID 166980292) has the molecular formula C33H32F3NO6 and a molecular weight of 595.61 g/mol. Its IUPAC name is (Z)-4-oxo-4-[4-[4-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]prop-2-enoyl]oxybutyl]anilino]but-2-enoic acid.
| Compound Name | (Z)-4-oxo-4-[4-[4-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]prop-2-enoyl]oxybutyl]anilino]but-2-enoic acid |
|---|---|
| PubChem CID | 166980292 |
| Molecular Formula | C33H32F3NO6 |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | (Z)-4-oxo-4-[4-[4-[(E)-3-[4-[4-(4,4,4-trifluorobutoxy)phenyl]phenyl]prop-2-enoyl]oxybutyl]anilino]but-2-enoic acid |
| SMILES | O=C(O)/C=C\C(=O)Nc1ccc(CCCCOC(=O)/C=C/c2ccc(-c3ccc(OCCCC(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H32F3NO6/c34-33(35,36)21-3-23-42-29-16-12-27(13-17-29)26-10-5-25(6-11-26)9-20-32(41)43-22-2-1-4-24-7-14-28(15-8-24)37-30(38)18-19-31(39)40/h5-20H,1-4,21-23H2,(H,37,38)(H,39,40)/b19-18-,20-9+ |
| InChIKey | OFKTZGXXVRELJV-OAXSPEODSA-N |
| XLogP | 7.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|