C38H39N5O11 — CID 167117364
3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]-N-[2-[(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]propanamide (PubChem CID 167117364) has the molecular formula C38H39N5O11 and a molecular weight of 741.75 g/mol. Its IUPAC name is 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]-N-[2-[(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]propanamide.
| Compound Name | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]-N-[2-[(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]propanamide |
|---|---|
| PubChem CID | 167117364 |
| Molecular Formula | C38H39N5O11 |
| Molecular Weight | 741.75 g/mol |
| Exact Mass | 741.26 |
| IUPAC Name | 3-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]-N-[2-[(3-ethoxy-4-methoxyphenyl)methyl]-1,3-dioxoisoindol-4-yl]propanamide |
| SMILES | CCOc1cc(CN2C(=O)c3cccc(NC(=O)CCOCCOCCNc4cccc5c4C(=O)N(C4CCC(=O)NC4=O)C5=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C38H39N5O11/c1-3-54-29-20-22(10-12-28(29)51-2)21-42-35(47)23-6-5-9-26(33(23)37(42)49)40-31(45)14-16-52-18-19-53-17-15-39-25-8-4-7-24-32(25)38(50)43(36(24)48)27-11-13-30(44)41-34(27)46/h4-10,12,20,27,39H,3,11,13-19,21H2,1-2H3,(H,40,45)(H,41,44,46) |
| InChIKey | AJMIZVHUUSLRPV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 198.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|