C19H12Cl2FN7O — CID 167135579
N'-[4-[2-chloro-4-[(6-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-fluorophenoxy]-2-pyridinyl]methanimidamide (PubChem CID 167135579) has the molecular formula C19H12Cl2FN7O and a molecular weight of 444.26 g/mol. Its IUPAC name is N'-[4-[2-chloro-4-[(6-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-fluorophenoxy]-2-pyridinyl]methanimidamide.
| Compound Name | N'-[4-[2-chloro-4-[(6-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-fluorophenoxy]-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 167135579 |
| Molecular Formula | C19H12Cl2FN7O |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | N'-[4-[2-chloro-4-[(6-chloropyrido[3,4-d]pyrimidin-4-yl)amino]-5-fluorophenoxy]-2-pyridinyl]methanimidamide |
| SMILES | N/C=N/c1cc(Oc2cc(F)c(Nc3ncnc4cnc(Cl)cc34)cc2Cl)ccn1 |
| InChI | InChI=1S/C19H12Cl2FN7O/c20-12-5-14(29-19-11-4-17(21)25-7-15(11)27-9-28-19)13(22)6-16(12)30-10-1-2-24-18(3-10)26-8-23/h1-9H,(H2,23,24,26)(H,27,28,29) |
| InChIKey | NZADRIXIAFBATI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|