C20H33ClN5O8PS — CID 167163190
[1-[[(2S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-4-hydroxyoxolan-2-yl]methoxy]-2-ethylsulfonylethyl]phosphonic acid (PubChem CID 167163190) has the molecular formula C20H33ClN5O8PS and a molecular weight of 570.01 g/mol. Its IUPAC name is [1-[[(2S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-4-hydroxyoxolan-2-yl]methoxy]-2-ethylsulfonylethyl]phosphonic acid.
| Compound Name | [1-[[(2S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-4-hydroxyoxolan-2-yl]methoxy]-2-ethylsulfonylethyl]phosphonic acid |
|---|---|
| PubChem CID | 167163190 |
| Molecular Formula | C20H33ClN5O8PS |
| Molecular Weight | 570.01 g/mol |
| Exact Mass | 569.15 |
| IUPAC Name | [1-[[(2S,4R,5R)-5-[[2-chloro-6-(cyclopentylamino)-5-methylpyrimidin-4-yl]-(methylideneamino)amino]-4-hydroxyoxolan-2-yl]methoxy]-2-ethylsulfonylethyl]phosphonic acid |
| SMILES | C=NN(c1nc(Cl)nc(NC2CCCC2)c1C)[C@@H]1O[C@H](COC(CS(=O)(=O)CC)P(=O)(O)O)C[C@H]1O |
| InChI | InChI=1S/C20H33ClN5O8PS/c1-4-36(31,32)11-16(35(28,29)30)33-10-14-9-15(27)19(34-14)26(22-3)18-12(2)17(24-20(21)25-18)23-13-7-5-6-8-13/h13-16,19,27H,3-11H2,1-2H3,(H,23,24,25)(H2,28,29,30)/t14-,15+,16?,19+/m0/s1 |
| InChIKey | BPPZZYQYYSHFSH-ZUHAFGJZSA-N |
| XLogP | 1.65 |
| TPSA | 183.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.01 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|