C6H15N3OS2 — CID 167215078
(2S)-2,6-diamino-N-(disulfanyl)hexanamide (PubChem CID 167215078) has the molecular formula C6H15N3OS2 and a molecular weight of 209.34 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(disulfanyl)hexanamide.
| Compound Name | (2S)-2,6-diamino-N-(disulfanyl)hexanamide |
|---|---|
| PubChem CID | 167215078 |
| Molecular Formula | C6H15N3OS2 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2S)-2,6-diamino-N-(disulfanyl)hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NSS |
| InChI | InChI=1S/C6H15N3OS2/c7-4-2-1-3-5(8)6(10)9-12-11/h5,11H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | GOTHZCQEORQYHN-YFKPBYRVSA-N |
| XLogP | 0.05 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|