C33H27BNO2+ — CID 167317348
1,4,5-trimethyl-2-(7-methyl-12-phenyl-2,10-dioxa-12-borapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium (PubChem CID 167317348) has the molecular formula C33H27BNO2+ and a molecular weight of 480.40 g/mol. Its IUPAC name is 1,4,5-trimethyl-2-(7-methyl-12-phenyl-2,10-dioxa-12-borapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium.
| Compound Name | 1,4,5-trimethyl-2-(7-methyl-12-phenyl-2,10-dioxa-12-borapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167317348 |
| Molecular Formula | C33H27BNO2+ |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 1,4,5-trimethyl-2-(7-methyl-12-phenyl-2,10-dioxa-12-borapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(13),3(11),4(9),5,7,14,16,18,20-nonaen-8-yl)pyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)ccc3c4c(oc23)B(c2ccccc2)c2c(ccc3ccccc23)O4)[n+](C)cc1C |
| InChI | InChI=1S/C33H27BNO2/c1-20-14-16-26-31(29(20)27-18-21(2)22(3)19-35(27)4)37-33-32(26)36-28-17-15-23-10-8-9-13-25(23)30(28)34(33)24-11-6-5-7-12-24/h5-19H,1-4H3/q+1 |
| InChIKey | LNSDIEVICBVDLP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|