C24H39F2N3O2 — CID 167348704
N-[3-(1-acetyl-4-methylpiperidin-4-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167348704) has the molecular formula C24H39F2N3O2 and a molecular weight of 439.59 g/mol. Its IUPAC name is N-[3-(1-acetyl-4-methylpiperidin-4-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(1-acetyl-4-methylpiperidin-4-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167348704 |
| Molecular Formula | C24H39F2N3O2 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-[3-(1-acetyl-4-methylpiperidin-4-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC(=O)N1CCC(C)(C2CC(F)CC(NC(=O)C3CC4C(F)CCC(C)C4N3)C2)CC1 |
| InChI | InChI=1S/C24H39F2N3O2/c1-14-4-5-20(26)19-13-21(28-22(14)19)23(31)27-18-11-16(10-17(25)12-18)24(3)6-8-29(9-7-24)15(2)30/h14,16-22,28H,4-13H2,1-3H3,(H,27,31) |
| InChIKey | NQTSBNNIEYYYJA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |