C24H38F4N4O — CID 167380524
N-[3-(6,6-difluoro-2,8-diazaspiro[4.5]decan-2-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 167380524) has the molecular formula C24H38F4N4O and a molecular weight of 474.59 g/mol. Its IUPAC name is N-[3-(6,6-difluoro-2,8-diazaspiro[4.5]decan-2-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(6,6-difluoro-2,8-diazaspiro[4.5]decan-2-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167380524 |
| Molecular Formula | C24H38F4N4O |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | N-[3-(6,6-difluoro-2,8-diazaspiro[4.5]decan-2-yl)-5-fluorocyclohexyl]-4-fluoro-7-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CC1CCC(F)C2CC(C(=O)NC3CC(F)CC(N4CCC5(CCNCC5(F)F)C4)C3)NC12 |
| InChI | InChI=1S/C24H38F4N4O/c1-14-2-3-19(26)18-11-20(31-21(14)18)22(33)30-16-8-15(25)9-17(10-16)32-7-5-23(13-32)4-6-29-12-24(23,27)28/h14-21,29,31H,2-13H2,1H3,(H,30,33) |
| InChIKey | ASQFKBVXNWOLEA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |