C24H27N2O+ — CID 167365125
7-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-1,3,8-trimethyl-[1]benzofuro[2,3-c]pyridine (PubChem CID 167365125) has the molecular formula C24H27N2O+ and a molecular weight of 359.49 g/mol. Its IUPAC name is 7-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-1,3,8-trimethyl-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 7-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-1,3,8-trimethyl-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 167365125 |
| Molecular Formula | C24H27N2O+ |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 7-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-1,3,8-trimethyl-[1]benzofuro[2,3-c]pyridine |
| SMILES | Cc1cc2c(oc3c(C)c(-c4ccc(C(C)(C)C)c[n+]4C)ccc32)c(C)n1 |
| InChI | InChI=1S/C24H27N2O/c1-14-12-20-19-10-9-18(15(2)22(19)27-23(20)16(3)25-14)21-11-8-17(13-26(21)7)24(4,5)6/h8-13H,1-7H3/q+1 |
| InChIKey | AJHDOXAOFIHAQW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 29.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|