C8H16FO6P — CID 167491430
2-[(3R,6R)-2-fluoro-3,4,5,6-tetrahydroxycyclohexyl]ethylphosphonous acid (PubChem CID 167491430) has the molecular formula C8H16FO6P and a molecular weight of 258.18 g/mol. Its IUPAC name is 2-[(3R,6R)-2-fluoro-3,4,5,6-tetrahydroxycyclohexyl]ethylphosphonous acid.
| Compound Name | 2-[(3R,6R)-2-fluoro-3,4,5,6-tetrahydroxycyclohexyl]ethylphosphonous acid |
|---|---|
| PubChem CID | 167491430 |
| Molecular Formula | C8H16FO6P |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[(3R,6R)-2-fluoro-3,4,5,6-tetrahydroxycyclohexyl]ethylphosphonous acid |
| SMILES | OC1C(O)[C@H](O)C(CCP(O)O)C(F)[C@@H]1O |
| InChI | InChI=1S/C8H16FO6P/c9-4-3(1-2-16(14)15)5(10)7(12)8(13)6(4)11/h3-8,10-15H,1-2H2/t3?,4?,5-,6+,7?,8?/m1/s1 |
| InChIKey | KDSVTLWOQJHECL-QVNOZGMTSA-N |
| XLogP | -1.92 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|