C46H37ClN4O7 — CID 167570633
5-acetyl-2-[4-[[4-(methylamino)phenyl]methyl]phenyl]isoindole-1,3-dione;4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carbonyl chloride (PubChem CID 167570633) has the molecular formula C46H37ClN4O7 and a molecular weight of 793.28 g/mol. Its IUPAC name is 5-acetyl-2-[4-[[4-(methylamino)phenyl]methyl]phenyl]isoindole-1,3-dione;4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carbonyl chloride.
| Compound Name | 5-acetyl-2-[4-[[4-(methylamino)phenyl]methyl]phenyl]isoindole-1,3-dione;4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carbonyl chloride |
|---|---|
| PubChem CID | 167570633 |
| Molecular Formula | C46H37ClN4O7 |
| Molecular Weight | 793.28 g/mol |
| Exact Mass | 792.24 |
| IUPAC Name | 5-acetyl-2-[4-[[4-(methylamino)phenyl]methyl]phenyl]isoindole-1,3-dione;4-[(4-aminophenyl)methyl]aniline;1,3-dioxo-2-benzofuran-5-carbonyl chloride |
| SMILES | CNc1ccc(Cc2ccc(N3C(=O)c4ccc(C(C)=O)cc4C3=O)cc2)cc1.Nc1ccc(Cc2ccc(N)cc2)cc1.O=C(Cl)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C24H20N2O3.C13H14N2.C9H3ClO4/c1-15(27)18-7-12-21-22(14-18)24(29)26(23(21)28)20-10-5-17(6-11-20)13-16-3-8-19(25-2)9-4-16;14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12/h3-12,14,25H,13H2,1-2H3;1-8H,9,14-15H2;1-3H |
| InChIKey | FWAOVURCWFUBEW-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 178.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.28 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|