C32H31N3O8 — CID 16759796
trimethyl (1S,9R,15S)-8-but-2-ynyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759796) has the molecular formula C32H31N3O8 and a molecular weight of 585.61 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-8-but-2-ynyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-8-but-2-ynyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759796 |
| Molecular Formula | C32H31N3O8 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | trimethyl (1S,9R,15S)-8-but-2-ynyl-14-(2-phenylmethoxyacetyl)-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | CC#CCN1c2ccccc2[C@]23C[C@@H](C(=O)OC)N(C(=O)COCc4ccccc4)C2=NC(C(=O)OC)=C(C(=O)OC)[C@H]13 |
| InChI | InChI=1S/C32H31N3O8/c1-5-6-16-34-22-15-11-10-14-21(22)32-17-23(28(37)40-2)35(24(36)19-43-18-20-12-8-7-9-13-20)31(32)33-26(30(39)42-4)25(27(32)34)29(38)41-3/h7-15,23,27H,16-19H2,1-4H3/t23-,27-,32-/m0/s1 |
| InChIKey | CNQVWHAJBJQMGK-BHRZLAGCSA-N |
| XLogP | 2.14 |
| TPSA | 124.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|