C34H32BrN3O8S — CID 53315913
CID 53315913 (PubChem CID 53315913) has the molecular formula C34H32BrN3O8S and a molecular weight of 722.61 g/mol.
| Compound Name | CID 53315913 |
|---|---|
| PubChem CID | 53315913 |
| Molecular Formula | C34H32BrN3O8S |
| Molecular Weight | 722.61 g/mol |
| Exact Mass | 721.11 |
| IUPAC Name | — |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2N(Cc3ccccc3)c3ccccc3[C@@]23C[C@@H](C(=O)OC)N([S+](=O)([O-])c2ccc(Br)cc2)C3=N1 |
| InChI | InChI=1S/C34H32BrN3O8S/c1-4-45-31(40)27-28(32(41)46-5-2)36-33-34(19-26(30(39)44-3)38(33)47(42,43)23-17-15-22(35)16-18-23)24-13-9-10-14-25(24)37(29(27)34)20-21-11-7-6-8-12-21/h6-18,26,29H,4-5,19-20H2,1-3H3/t26-,29?,34-/m0/s1 |
| InChIKey | KPUGBUZWRIYLGR-ZZDADZMISA-N |
| XLogP | 4.72 |
| TPSA | 137.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|