C14H15ClN2O2S — CID 167759954
6-chloro-1,1-dioxo-N-(spiro[2.3]hexan-5-ylmethyl)-1,2-benzothiazol-3-imine (PubChem CID 167759954) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-N-(spiro[2.3]hexan-5-ylmethyl)-1,2-benzothiazol-3-imine.
| Compound Name | 6-chloro-1,1-dioxo-N-(spiro[2.3]hexan-5-ylmethyl)-1,2-benzothiazol-3-imine |
|---|---|
| PubChem CID | 167759954 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 6-chloro-1,1-dioxo-N-(spiro[2.3]hexan-5-ylmethyl)-1,2-benzothiazol-3-imine |
| SMILES | O=S1(=O)N/C(=N\CC2CC3(CC3)C2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H15ClN2O2S/c15-10-1-2-11-12(5-10)20(18,19)17-13(11)16-8-9-6-14(7-9)3-4-14/h1-2,5,9H,3-4,6-8H2,(H,16,17) |
| InChIKey | IHMJVZUEVRBRRK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|