C11H19BrN4O3 — CID 168503415
2-amino-5-[[amino-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methylidene]amino]pentanoic acid (PubChem CID 168503415) has the molecular formula C11H19BrN4O3 and a molecular weight of 335.20 g/mol. Its IUPAC name is 2-amino-5-[[amino-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methylidene]amino]pentanoic acid.
| Compound Name | 2-amino-5-[[amino-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 168503415 |
| Molecular Formula | C11H19BrN4O3 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-amino-5-[[amino-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]methylidene]amino]pentanoic acid |
| SMILES | N/C(=N\CCCC(N)C(=O)O)N1CC(CBr)CC1=O |
| InChI | InChI=1S/C11H19BrN4O3/c12-5-7-4-9(17)16(6-7)11(14)15-3-1-2-8(13)10(18)19/h7-8H,1-6,13H2,(H2,14,15)(H,18,19) |
| InChIKey | DUAZPYVBRFMFSA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|