C10H18N4O2 — CID 44570132
(2S)-2-amino-5-[[amino(2,5-dihydropyrrol-1-yl)methylidene]amino]pentanoic acid (PubChem CID 44570132) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino(2,5-dihydropyrrol-1-yl)methylidene]amino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[amino(2,5-dihydropyrrol-1-yl)methylidene]amino]pentanoic acid |
|---|---|
| PubChem CID | 44570132 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (2S)-2-amino-5-[[amino(2,5-dihydropyrrol-1-yl)methylidene]amino]pentanoic acid |
| SMILES | N/C(=N\CCC[C@H](N)C(=O)O)N1CC=CC1 |
| InChI | InChI=1S/C10H18N4O2/c11-8(9(15)16)4-3-5-13-10(12)14-6-1-2-7-14/h1-2,8H,3-7,11H2,(H2,12,13)(H,15,16)/t8-/m0/s1 |
| InChIKey | VFLIRWVIVSORKC-QMMMGPOBSA-N |
| XLogP | -0.63 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|