C20H32N3O5P — CID 168931284
methyl 2-[[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-methoxyphosphoryl]amino]-3-methylbutanoate (PubChem CID 168931284) has the molecular formula C20H32N3O5P and a molecular weight of 425.47 g/mol. Its IUPAC name is methyl 2-[[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-methoxyphosphoryl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-methoxyphosphoryl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 168931284 |
| Molecular Formula | C20H32N3O5P |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | methyl 2-[[[3-[2-(dimethylamino)ethyl]-6-methoxyindol-1-yl]-methoxyphosphoryl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NP(=O)(OC)n1cc(CCN(C)C)c2ccc(OC)cc21)C(C)C |
| InChI | InChI=1S/C20H32N3O5P/c1-14(2)19(20(24)27-6)21-29(25,28-7)23-13-15(10-11-22(3)4)17-9-8-16(26-5)12-18(17)23/h8-9,12-14,19H,10-11H2,1-7H3,(H,21,25) |
| InChIKey | ZAYOCBJUXHPABG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|