C39H34Cl2F4N2O6S — CID 169029635
4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[[2-[(2,3-dichlorophenyl)methyl]-3,4,5,6-tetrafluorophenyl]sulfamoyl]acetyl]amino]-3-prop-2-ynoxybenzoic acid (PubChem CID 169029635) has the molecular formula C39H34Cl2F4N2O6S and a molecular weight of 805.67 g/mol. Its IUPAC name is 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[[2-[(2,3-dichlorophenyl)methyl]-3,4,5,6-tetrafluorophenyl]sulfamoyl]acetyl]amino]-3-prop-2-ynoxybenzoic acid.
| Compound Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[[2-[(2,3-dichlorophenyl)methyl]-3,4,5,6-tetrafluorophenyl]sulfamoyl]acetyl]amino]-3-prop-2-ynoxybenzoic acid |
|---|---|
| PubChem CID | 169029635 |
| Molecular Formula | C39H34Cl2F4N2O6S |
| Molecular Weight | 805.67 g/mol |
| Exact Mass | 804.15 |
| IUPAC Name | 4-[(3-tert-butyl-5-cyclopropylphenyl)methyl-[2-[[2-[(2,3-dichlorophenyl)methyl]-3,4,5,6-tetrafluorophenyl]sulfamoyl]acetyl]amino]-3-prop-2-ynoxybenzoic acid |
| SMILES | C#CCOc1cc(C(=O)O)ccc1N(Cc1cc(C2CC2)cc(C(C)(C)C)c1)C(=O)CS(=O)(=O)Nc1c(F)c(F)c(F)c(F)c1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C39H34Cl2F4N2O6S/c1-5-13-53-30-18-24(38(49)50)11-12-29(30)47(19-21-14-25(22-9-10-22)16-26(15-21)39(2,3)4)31(48)20-54(51,52)46-37-27(33(42)34(43)35(44)36(37)45)17-23-7-6-8-28(40)32(23)41/h1,6-8,11-12,14-16,18,22,46H,9-10,13,17,19-20H2,2-4H3,(H,49,50) |
| InChIKey | BONJFWDSIDGYLB-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.67 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|