C19H40N2O — CID 169112365
(2R,3E,5E)-5-[2-(dimethylamino)propoxy]-3-methyl-N-(2-methylpropyl)hepta-3,5-dien-2-amine;ethane (PubChem CID 169112365) has the molecular formula C19H40N2O and a molecular weight of 312.54 g/mol. Its IUPAC name is (2R,3E,5E)-5-[2-(dimethylamino)propoxy]-3-methyl-N-(2-methylpropyl)hepta-3,5-dien-2-amine;ethane.
| Compound Name | (2R,3E,5E)-5-[2-(dimethylamino)propoxy]-3-methyl-N-(2-methylpropyl)hepta-3,5-dien-2-amine;ethane |
|---|---|
| PubChem CID | 169112365 |
| Molecular Formula | C19H40N2O |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.31 |
| IUPAC Name | (2R,3E,5E)-5-[2-(dimethylamino)propoxy]-3-methyl-N-(2-methylpropyl)hepta-3,5-dien-2-amine;ethane |
| SMILES | C/C=C(\C=C(/C)[C@@H](C)NCC(C)C)OCC(C)N(C)C.CC |
| InChI | InChI=1S/C17H34N2O.C2H6/c1-9-17(20-12-15(5)19(7)8)10-14(4)16(6)18-11-13(2)3;1-2/h9-10,13,15-16,18H,11-12H2,1-8H3;1-2H3/b14-10+,17-9+;/t15?,16-;/m1./s1 |
| InChIKey | DGTCRIXMPXHSHZ-HTRGKKGDSA-N |
| XLogP | 4.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|