C11H15F — CID 169145908
1-[(1E)-1-fluorobuta-1,3-dienyl]-2,3-dimethylcyclopentene (PubChem CID 169145908) has the molecular formula C11H15F and a molecular weight of 166.24 g/mol. Its IUPAC name is 1-[(1E)-1-fluorobuta-1,3-dienyl]-2,3-dimethylcyclopentene.
| Compound Name | 1-[(1E)-1-fluorobuta-1,3-dienyl]-2,3-dimethylcyclopentene |
|---|---|
| PubChem CID | 169145908 |
| Molecular Formula | C11H15F |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1-[(1E)-1-fluorobuta-1,3-dienyl]-2,3-dimethylcyclopentene |
| SMILES | C=C/C=C(/F)C1=C(C)C(C)CC1 |
| InChI | InChI=1S/C11H15F/c1-4-5-11(12)10-7-6-8(2)9(10)3/h4-5,8H,1,6-7H2,2-3H3/b11-5+ |
| InChIKey | FPJIOGYWCWTYFJ-VZUCSPMQSA-N |
| XLogP | 3.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|