C12H10F2IrN5O2- — CID 169190543
[9-[5-ethynyl-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]azanide;iridium (PubChem CID 169190543) has the molecular formula C12H10F2IrN5O2- and a molecular weight of 486.46 g/mol. Its IUPAC name is [9-[5-ethynyl-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]azanide;iridium.
| Compound Name | [9-[5-ethynyl-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]azanide;iridium |
|---|---|
| PubChem CID | 169190543 |
| Molecular Formula | C12H10F2IrN5O2- |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [9-[5-ethynyl-3-fluoro-5-(hydroxymethyl)oxolan-2-yl]-2-fluoropurin-6-yl]azanide;iridium |
| SMILES | C#CC1(CO)CC(F)C(n2cnc3c([NH-])nc(F)nc32)O1.[Ir] |
| InChI | InChI=1S/C12H10F2N5O2.Ir/c1-2-12(4-20)3-6(13)10(21-12)19-5-16-7-8(15)17-11(14)18-9(7)19;/h1,5-6,10,20H,3-4H2,(H-,15,17,18);/q-1; |
| InChIKey | HEFNDCUOKJNXBC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|