C22H30N2O10S — CID 169316334
4-O-[(4R)-3,3-dimethyl-5,9,14,16,19-pentaoxo-1-oxa-13-thia-6,10-diazacyclononadec-4-yl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 169316334) has the molecular formula C22H30N2O10S and a molecular weight of 514.55 g/mol. Its IUPAC name is 4-O-[(4R)-3,3-dimethyl-5,9,14,16,19-pentaoxo-1-oxa-13-thia-6,10-diazacyclononadec-4-yl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[(4R)-3,3-dimethyl-5,9,14,16,19-pentaoxo-1-oxa-13-thia-6,10-diazacyclononadec-4-yl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 169316334 |
| Molecular Formula | C22H30N2O10S |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 4-O-[(4R)-3,3-dimethyl-5,9,14,16,19-pentaoxo-1-oxa-13-thia-6,10-diazacyclononadec-4-yl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)O[C@H]1C(=O)NCCC(=O)NCCSC(=O)CC(=O)CCC(=O)OCC1(C)C |
| InChI | InChI=1S/C22H30N2O10S/c1-22(2)13-33-17(28)5-4-14(25)12-19(30)35-11-10-23-15(26)8-9-24-21(31)20(22)34-18(29)7-6-16(27)32-3/h6-7,20H,4-5,8-13H2,1-3H3,(H,23,26)(H,24,31)/b7-6+/t20-/m0/s1 |
| InChIKey | WFLRKBCXGPBWHY-YJJPMGAVSA-N |
| XLogP | -0.17 |
| TPSA | 171.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|