C14H16N4O8 — CID 169443707
(2S)-2-amino-5-[5,7-dinitro-4-(trideuteriomethoxy)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid (PubChem CID 169443707) has the molecular formula C14H16N4O8 and a molecular weight of 371.32 g/mol. Its IUPAC name is (2S)-2-amino-5-[5,7-dinitro-4-(trideuteriomethoxy)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[5,7-dinitro-4-(trideuteriomethoxy)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 169443707 |
| Molecular Formula | C14H16N4O8 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (2S)-2-amino-5-[5,7-dinitro-4-(trideuteriomethoxy)-2,3-dihydroindol-1-yl]-5-oxopentanoic acid |
| SMILES | [2H]C([2H])([2H])Oc1c([N+](=O)[O-])cc([N+](=O)[O-])c2c1CCN2C(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H16N4O8/c1-26-13-7-4-5-16(11(19)3-2-8(15)14(20)21)12(7)9(17(22)23)6-10(13)18(24)25/h6,8H,2-5,15H2,1H3,(H,20,21)/t8-/m0/s1/i1D3 |
| InChIKey | SYNWQVVPBORTQE-TUWYYBGVSA-N |
| XLogP | 0.59 |
| TPSA | 179.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|