C24H35N3O6S — CID 170086176
N-[1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-(4-hydroxybutoxy)-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide (PubChem CID 170086176) has the molecular formula C24H35N3O6S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-[1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-(4-hydroxybutoxy)-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide.
| Compound Name | N-[1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-(4-hydroxybutoxy)-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 170086176 |
| Molecular Formula | C24H35N3O6S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[1-[4-(cyclopropylmethoxy)-6-oxopyran-2-yl]butyl]-2-[(E)-N-(4-hydroxybutoxy)-C-methylcarbonimidoyl]-4-methyl-5H-1,3-thiazole-4-carboxamide |
| SMILES | CCCC(NC(=O)C1(C)CSC(/C(C)=N/OCCCCO)=N1)c1cc(OCC2CC2)cc(=O)o1 |
| InChI | InChI=1S/C24H35N3O6S/c1-4-7-19(20-12-18(13-21(29)33-20)31-14-17-8-9-17)25-23(30)24(3)15-34-22(26-24)16(2)27-32-11-6-5-10-28/h12-13,17,19,28H,4-11,14-15H2,1-3H3,(H,25,30)/b27-16+ |
| InChIKey | UEJWECMVYRUGMG-JVWAILMASA-N |
| XLogP | 3.45 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|