C22H21N — CID 170101115
(6E)-6-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethylidene]-4-ethenylcyclohexa-2,4-dien-1-imine (PubChem CID 170101115) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is (6E)-6-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethylidene]-4-ethenylcyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-6-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethylidene]-4-ethenylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 170101115 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (6E)-6-[1-(4-cyclohexa-1,5-dien-1-ylphenyl)ethylidene]-4-ethenylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC(C=C)=C\C1=C(\C)c1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C22H21N/c1-3-17-9-14-22(23)21(15-17)16(2)18-10-12-20(13-11-18)19-7-5-4-6-8-19/h3,5,7-15,23H,1,4,6H2,2H3/b21-16+,23-22+ |
| InChIKey | CTQHYUJPRBIFGJ-NDKFDOQPSA-N |
| XLogP | 5.90 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|